C35H41N5O5 — CID 46879114
(2S)-1-[(2R)-2-[[(2S)-3-methyl-2-[[(2R)-3-phenyl-2-[(4-phenylbenzoyl)amino]propanoyl]amino]butanoyl]amino]propanoyl]pyrrolidine-2-carboxamide (PubChem CID 46879114) has the molecular formula C35H41N5O5 and a molecular weight of 611.74 g/mol. Its IUPAC name is (2S)-1-[(2R)-2-[[(2S)-3-methyl-2-[[(2R)-3-phenyl-2-[(4-phenylbenzoyl)amino]propanoyl]amino]butanoyl]amino]propanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2R)-2-[[(2S)-3-methyl-2-[[(2R)-3-phenyl-2-[(4-phenylbenzoyl)amino]propanoyl]amino]butanoyl]amino]propanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 46879114 |
| Molecular Formula | C35H41N5O5 |
| Molecular Weight | 611.74 g/mol |
| Exact Mass | 611.31 |
| IUPAC Name | (2S)-1-[(2R)-2-[[(2S)-3-methyl-2-[[(2R)-3-phenyl-2-[(4-phenylbenzoyl)amino]propanoyl]amino]butanoyl]amino]propanoyl]pyrrolidine-2-carboxamide |
| SMILES | CC(C)[C@H](NC(=O)[C@@H](Cc1ccccc1)NC(=O)c1ccc(-c2ccccc2)cc1)C(=O)N[C@H](C)C(=O)N1CCC[C@H]1C(N)=O |
| InChI | InChI=1S/C35H41N5O5/c1-22(2)30(34(44)37-23(3)35(45)40-20-10-15-29(40)31(36)41)39-33(43)28(21-24-11-6-4-7-12-24)38-32(42)27-18-16-26(17-19-27)25-13-8-5-9-14-25/h4-9,11-14,16-19,22-23,28-30H,10,15,20-21H2,1-3H3,(H2,36,41)(H,37,44)(H,38,42)(H,39,43)/t23-,28-,29+,30+/m1/s1 |
| InChIKey | VLAGXIPUVMYMFE-HYPLZALKSA-N |
| XLogP | 2.82 |
| TPSA | 150.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.74 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |