C34H32ClN9O — CID 46879140
2-N-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]-6-(4-methylpiperazin-1-yl)-4-N-phenyl-1,3,5-triazine-2,4-diamine (PubChem CID 46879140) has the molecular formula C34H32ClN9O and a molecular weight of 618.15 g/mol. Its IUPAC name is 2-N-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]-6-(4-methylpiperazin-1-yl)-4-N-phenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]-6-(4-methylpiperazin-1-yl)-4-N-phenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 46879140 |
| Molecular Formula | C34H32ClN9O |
| Molecular Weight | 618.15 g/mol |
| Exact Mass | 617.24 |
| IUPAC Name | 2-N-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]-6-(4-methylpiperazin-1-yl)-4-N-phenyl-1,3,5-triazine-2,4-diamine |
| SMILES | COc1ccc2nc3cc(Cl)ccc3c(Nc3ccc(Nc4nc(Nc5ccccc5)nc(N5CCN(C)CC5)n4)cc3)c2c1 |
| InChI | InChI=1S/C34H32ClN9O/c1-43-16-18-44(19-17-43)34-41-32(37-23-6-4-3-5-7-23)40-33(42-34)38-25-11-9-24(10-12-25)36-31-27-14-8-22(35)20-30(27)39-29-15-13-26(45-2)21-28(29)31/h3-15,20-21H,16-19H2,1-2H3,(H,36,39)(H2,37,38,40,41,42) |
| InChIKey | MPISXMUMXVRLDV-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 103.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.15 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|