C33H32ClN9O — CID 46879144
2-N-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]-6-N-[2-(dimethylamino)ethyl]-4-N-phenyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 46879144) has the molecular formula C33H32ClN9O and a molecular weight of 606.13 g/mol. Its IUPAC name is 2-N-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]-6-N-[2-(dimethylamino)ethyl]-4-N-phenyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]-6-N-[2-(dimethylamino)ethyl]-4-N-phenyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 46879144 |
| Molecular Formula | C33H32ClN9O |
| Molecular Weight | 606.13 g/mol |
| Exact Mass | 605.24 |
| IUPAC Name | 2-N-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]-6-N-[2-(dimethylamino)ethyl]-4-N-phenyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | COc1ccc2nc3cc(Cl)ccc3c(Nc3ccc(Nc4nc(NCCN(C)C)nc(Nc5ccccc5)n4)cc3)c2c1 |
| InChI | InChI=1S/C33H32ClN9O/c1-43(2)18-17-35-31-40-32(37-22-7-5-4-6-8-22)42-33(41-31)38-24-12-10-23(11-13-24)36-30-26-15-9-21(34)19-29(26)39-28-16-14-25(44-3)20-27(28)30/h4-16,19-20H,17-18H2,1-3H3,(H,36,39)(H3,35,37,38,40,41,42) |
| InChIKey | VZFJFSZCBBXKCG-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.13 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|