C35H36ClN9O — CID 46879145
2-N-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]-6-N-[2-(diethylamino)ethyl]-4-N-phenyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 46879145) has the molecular formula C35H36ClN9O and a molecular weight of 634.19 g/mol. Its IUPAC name is 2-N-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]-6-N-[2-(diethylamino)ethyl]-4-N-phenyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]-6-N-[2-(diethylamino)ethyl]-4-N-phenyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 46879145 |
| Molecular Formula | C35H36ClN9O |
| Molecular Weight | 634.19 g/mol |
| Exact Mass | 633.27 |
| IUPAC Name | 2-N-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]-6-N-[2-(diethylamino)ethyl]-4-N-phenyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCN(CC)CCNc1nc(Nc2ccccc2)nc(Nc2ccc(Nc3c4ccc(Cl)cc4nc4ccc(OC)cc34)cc2)n1 |
| InChI | InChI=1S/C35H36ClN9O/c1-4-45(5-2)20-19-37-33-42-34(39-24-9-7-6-8-10-24)44-35(43-33)40-26-14-12-25(13-15-26)38-32-28-17-11-23(36)21-31(28)41-30-18-16-27(46-3)22-29(30)32/h6-18,21-22H,4-5,19-20H2,1-3H3,(H,38,41)(H3,37,39,40,42,43,44) |
| InChIKey | LDWZGDZYRPAAAZ-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.19 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|