C33H31ClN8O — CID 46879146
6-N-butyl-2-N-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]-4-N-phenyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 46879146) has the molecular formula C33H31ClN8O and a molecular weight of 591.12 g/mol. Its IUPAC name is 6-N-butyl-2-N-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]-4-N-phenyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-butyl-2-N-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]-4-N-phenyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 46879146 |
| Molecular Formula | C33H31ClN8O |
| Molecular Weight | 591.12 g/mol |
| Exact Mass | 590.23 |
| IUPAC Name | 6-N-butyl-2-N-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]-4-N-phenyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCNc1nc(Nc2ccccc2)nc(Nc2ccc(Nc3c4ccc(Cl)cc4nc4ccc(OC)cc34)cc2)n1 |
| InChI | InChI=1S/C33H31ClN8O/c1-3-4-18-35-31-40-32(37-22-8-6-5-7-9-22)42-33(41-31)38-24-13-11-23(12-14-24)36-30-26-16-10-21(34)19-29(26)39-28-17-15-25(43-2)20-27(28)30/h5-17,19-20H,3-4,18H2,1-2H3,(H,36,39)(H3,35,37,38,40,41,42) |
| InChIKey | CHLNZJZXCZLXKI-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 108.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.12 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|