C32H29ClN8O2 — CID 46879149
3-[[4-anilino-6-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]anilino]-1,3,5-triazin-2-yl]amino]propan-1-ol (PubChem CID 46879149) has the molecular formula C32H29ClN8O2 and a molecular weight of 593.09 g/mol. Its IUPAC name is 3-[[4-anilino-6-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]anilino]-1,3,5-triazin-2-yl]amino]propan-1-ol.
| Compound Name | 3-[[4-anilino-6-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]anilino]-1,3,5-triazin-2-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 46879149 |
| Molecular Formula | C32H29ClN8O2 |
| Molecular Weight | 593.09 g/mol |
| Exact Mass | 592.21 |
| IUPAC Name | 3-[[4-anilino-6-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]anilino]-1,3,5-triazin-2-yl]amino]propan-1-ol |
| SMILES | COc1ccc2nc3cc(Cl)ccc3c(Nc3ccc(Nc4nc(NCCCO)nc(Nc5ccccc5)n4)cc3)c2c1 |
| InChI | InChI=1S/C32H29ClN8O2/c1-43-24-13-15-27-26(19-24)29(25-14-8-20(33)18-28(25)38-27)35-22-9-11-23(12-10-22)37-32-40-30(34-16-5-17-42)39-31(41-32)36-21-6-3-2-4-7-21/h2-4,6-15,18-19,42H,5,16-17H2,1H3,(H,35,38)(H3,34,36,37,39,40,41) |
| InChIKey | FYOMVZLUPUXDOP-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 129.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.09 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|