C35H33ClFN9O2 — CID 46879196
4-N-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]-2-N-(4-fluorophenyl)-6-N-(2-morpholin-4-ylethyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 46879196) has the molecular formula C35H33ClFN9O2 and a molecular weight of 666.16 g/mol. Its IUPAC name is 4-N-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]-2-N-(4-fluorophenyl)-6-N-(2-morpholin-4-ylethyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]-2-N-(4-fluorophenyl)-6-N-(2-morpholin-4-ylethyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 46879196 |
| Molecular Formula | C35H33ClFN9O2 |
| Molecular Weight | 666.16 g/mol |
| Exact Mass | 665.24 |
| IUPAC Name | 4-N-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]-2-N-(4-fluorophenyl)-6-N-(2-morpholin-4-ylethyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | COc1ccc2nc3cc(Cl)ccc3c(Nc3ccc(Nc4nc(NCCN5CCOCC5)nc(Nc5ccc(F)cc5)n4)cc3)c2c1 |
| InChI | InChI=1S/C35H33ClFN9O2/c1-47-27-11-13-30-29(21-27)32(28-12-2-22(36)20-31(28)42-30)39-24-7-9-26(10-8-24)41-35-44-33(38-14-15-46-16-18-48-19-17-46)43-34(45-35)40-25-5-3-23(37)4-6-25/h2-13,20-21H,14-19H2,1H3,(H,39,42)(H3,38,40,41,43,44,45) |
| InChIKey | JTYRQTLXVCTQBZ-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.16 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|