About (3S,4S)-3-(2-hydroxyethyl)-1,4-diphenylazetidin-2-one
(3S,4S)-3-(2-hydroxyethyl)-1,4-diphenylazetidin-2-one (PubChem CID 46879202) has the molecular formula C17H17NO2
and a molecular weight of 267.33 g/mol. Its IUPAC name is (3S,4S)-3-(2-hydroxyethyl)-1,4-diphenylazetidin-2-one.
Molecular Properties
| Compound Name | (3S,4S)-3-(2-hydroxyethyl)-1,4-diphenylazetidin-2-one |
| PubChem CID | 46879202 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | (3S,4S)-3-(2-hydroxyethyl)-1,4-diphenylazetidin-2-one |
| SMILES | O=C1[C@@H](CCO)[C@@H](c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C17H17NO2/c19-12-11-15-16(13-7-3-1-4-8-13)18(17(15)20)14-9-5-2-6-10-14/h1-10,15-16,19H,11-12H2/t15-,16+/m0/s1 |
| InChIKey | VIFVGEQLIJMMLU-JKSUJKDBSA-N |
| XLogP | 2.77 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S,4S)-3-(2-hydroxyethyl)-1,4-diphenylazetidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-3-(2-hydroxyethyl)-1,4-diphenylazetidin-2-one?
The IUPAC name of (3S,4S)-3-(2-hydroxyethyl)-1,4-diphenylazetidin-2-one (CID 46879202) is (3S,4S)-3-(2-hydroxyethyl)-1,4-diphenylazetidin-2-one.
What is the SMILES notation for (3S,4S)-3-(2-hydroxyethyl)-1,4-diphenylazetidin-2-one?
The canonical SMILES for (3S,4S)-3-(2-hydroxyethyl)-1,4-diphenylazetidin-2-one is O=C1[C@@H](CCO)[C@@H](c2ccccc2)N1c1ccccc1.
What is the InChIKey of (3S,4S)-3-(2-hydroxyethyl)-1,4-diphenylazetidin-2-one?
The InChIKey is VIFVGEQLIJMMLU-JKSUJKDBSA-N. The full InChI is InChI=1S/C17H17NO2/c19-12-11-15-16(13-7-3-1-4-8-13)18(17(15)20)14-9-5-2-6-10-14/h1-10,15-16,19H,11-12H2/t15-,16+/m0/s1.
What are the key properties of (3S,4S)-3-(2-hydroxyethyl)-1,4-diphenylazetidin-2-one?
(3S,4S)-3-(2-hydroxyethyl)-1,4-diphenylazetidin-2-one has a molecular weight of 267.33 g/mol, XLogP of 2.77, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-3-(2-hydroxyethyl)-1,4-diphenylazetidin-2-one is sourced from PubChem (CID 46879202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).