C27H38N8O4 — CID 46879333
N-[(2S)-1-[[(2S,3S)-1-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-3-methyl-1-oxopentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]pyridine-3-carboxamide (PubChem CID 46879333) has the molecular formula C27H38N8O4 and a molecular weight of 538.65 g/mol. Its IUPAC name is N-[(2S)-1-[[(2S,3S)-1-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-3-methyl-1-oxopentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]pyridine-3-carboxamide.
| Compound Name | N-[(2S)-1-[[(2S,3S)-1-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-3-methyl-1-oxopentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 46879333 |
| Molecular Formula | C27H38N8O4 |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 538.30 |
| IUPAC Name | N-[(2S)-1-[[(2S,3S)-1-[[(2S)-1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-3-methyl-1-oxopentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]pyridine-3-carboxamide |
| SMILES | CC[C@H](C)C(NC(=O)[C@H](Cc1ccccc1)NC(=O)c1cccnc1)C(=O)N[C@@H](CCCN=C(N)N)C(N)=O |
| InChI | InChI=1S/C27H38N8O4/c1-3-17(2)22(26(39)33-20(23(28)36)12-8-14-32-27(29)30)35-25(38)21(15-18-9-5-4-6-10-18)34-24(37)19-11-7-13-31-16-19/h4-7,9-11,13,16-17,20-22H,3,8,12,14-15H2,1-2H3,(H2,28,36)(H,33,39)(H,34,37)(H,35,38)(H4,29,30,32)/t17-,20-,21-,22?/m0/s1 |
| InChIKey | ZQJPROKGZSOEKR-JCRWLZENSA-N |
| XLogP | -0.02 |
| TPSA | 207.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|