C28H39N7O5 — CID 46879396
methyl (2S)-5-(diaminomethylideneamino)-2-[[(2S,3S)-3-methyl-2-[[(2S)-3-phenyl-2-(pyridine-3-carbonylamino)propanoyl]amino]pentanoyl]amino]pentanoate (PubChem CID 46879396) has the molecular formula C28H39N7O5 and a molecular weight of 553.66 g/mol. Its IUPAC name is methyl (2S)-5-(diaminomethylideneamino)-2-[[(2S,3S)-3-methyl-2-[[(2S)-3-phenyl-2-(pyridine-3-carbonylamino)propanoyl]amino]pentanoyl]amino]pentanoate.
| Compound Name | methyl (2S)-5-(diaminomethylideneamino)-2-[[(2S,3S)-3-methyl-2-[[(2S)-3-phenyl-2-(pyridine-3-carbonylamino)propanoyl]amino]pentanoyl]amino]pentanoate |
|---|---|
| PubChem CID | 46879396 |
| Molecular Formula | C28H39N7O5 |
| Molecular Weight | 553.66 g/mol |
| Exact Mass | 553.30 |
| IUPAC Name | methyl (2S)-5-(diaminomethylideneamino)-2-[[(2S,3S)-3-methyl-2-[[(2S)-3-phenyl-2-(pyridine-3-carbonylamino)propanoyl]amino]pentanoyl]amino]pentanoate |
| SMILES | CC[C@H](C)C(NC(=O)[C@H](Cc1ccccc1)NC(=O)c1cccnc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)OC |
| InChI | InChI=1S/C28H39N7O5/c1-4-18(2)23(26(38)33-21(27(39)40-3)13-9-15-32-28(29)30)35-25(37)22(16-19-10-6-5-7-11-19)34-24(36)20-12-8-14-31-17-20/h5-8,10-12,14,17-18,21-23H,4,9,13,15-16H2,1-3H3,(H,33,38)(H,34,36)(H,35,37)(H4,29,30,32)/t18-,21-,22-,23?/m0/s1 |
| InChIKey | IKUKJKMSXLRTRG-QSGKVOPNSA-N |
| XLogP | 0.67 |
| TPSA | 190.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.66 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|