C8H15NO5 — CID 46879415
(1S,2R,5R,7R,8S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizine-1,2,5,7,8-pentol (PubChem CID 46879415) has the molecular formula C8H15NO5 and a molecular weight of 205.21 g/mol. Its IUPAC name is (1S,2R,5R,7R,8S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizine-1,2,5,7,8-pentol.
| Compound Name | (1S,2R,5R,7R,8S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizine-1,2,5,7,8-pentol |
|---|---|
| PubChem CID | 46879415 |
| Molecular Formula | C8H15NO5 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | (1S,2R,5R,7R,8S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizine-1,2,5,7,8-pentol |
| SMILES | O[C@H]1[C@H]2[C@H](O)[C@H](O)CN2[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C8H15NO5/c10-3-1-5(12)9-2-4(11)8(14)6(9)7(3)13/h3-8,10-14H,1-2H2/t3-,4-,5-,6+,7-,8-/m1/s1 |
| InChIKey | HHLGVTQXFOVXKK-CVBHLRHXSA-N |
| XLogP | -3.16 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | -3.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |