About 3-[9-[(2,6-difluorophenyl)methyl]-8-oxo-7H-purin-2-yl]benzimidazole-5-carbonitrile
3-[9-[(2,6-difluorophenyl)methyl]-8-oxo-7H-purin-2-yl]benzimidazole-5-carbonitrile (PubChem CID 46879420) has the molecular formula C20H11F2N7O
and a molecular weight of 403.35 g/mol. Its IUPAC name is 3-[9-[(2,6-difluorophenyl)methyl]-8-oxo-7H-purin-2-yl]benzimidazole-5-carbonitrile.
Molecular Properties
| Compound Name | 3-[9-[(2,6-difluorophenyl)methyl]-8-oxo-7H-purin-2-yl]benzimidazole-5-carbonitrile |
| PubChem CID | 46879420 |
| Molecular Formula | C20H11F2N7O |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 3-[9-[(2,6-difluorophenyl)methyl]-8-oxo-7H-purin-2-yl]benzimidazole-5-carbonitrile |
| SMILES | N#Cc1ccc2ncn(-c3ncc4[nH]c(=O)n(Cc5c(F)cccc5F)c4n3)c2c1 |
| InChI | InChI=1S/C20H11F2N7O/c21-13-2-1-3-14(22)12(13)9-28-18-16(26-20(28)30)8-24-19(27-18)29-10-25-15-5-4-11(7-23)6-17(15)29/h1-6,8,10H,9H2,(H,26,30) |
| InChIKey | MDEJMNFUZCWVBX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 105.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[9-[(2,6-difluorophenyl)methyl]-8-oxo-7H-purin-2-yl]benzimidazole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[9-[(2,6-difluorophenyl)methyl]-8-oxo-7H-purin-2-yl]benzimidazole-5-carbonitrile?
The IUPAC name of 3-[9-[(2,6-difluorophenyl)methyl]-8-oxo-7H-purin-2-yl]benzimidazole-5-carbonitrile (CID 46879420) is 3-[9-[(2,6-difluorophenyl)methyl]-8-oxo-7H-purin-2-yl]benzimidazole-5-carbonitrile.
What is the SMILES notation for 3-[9-[(2,6-difluorophenyl)methyl]-8-oxo-7H-purin-2-yl]benzimidazole-5-carbonitrile?
The canonical SMILES for 3-[9-[(2,6-difluorophenyl)methyl]-8-oxo-7H-purin-2-yl]benzimidazole-5-carbonitrile is N#Cc1ccc2ncn(-c3ncc4[nH]c(=O)n(Cc5c(F)cccc5F)c4n3)c2c1.
What is the InChIKey of 3-[9-[(2,6-difluorophenyl)methyl]-8-oxo-7H-purin-2-yl]benzimidazole-5-carbonitrile?
The InChIKey is MDEJMNFUZCWVBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H11F2N7O/c21-13-2-1-3-14(22)12(13)9-28-18-16(26-20(28)30)8-24-19(27-18)29-10-25-15-5-4-11(7-23)6-17(15)29/h1-6,8,10H,9H2,(H,26,30).
What are the key properties of 3-[9-[(2,6-difluorophenyl)methyl]-8-oxo-7H-purin-2-yl]benzimidazole-5-carbonitrile?
3-[9-[(2,6-difluorophenyl)methyl]-8-oxo-7H-purin-2-yl]benzimidazole-5-carbonitrile has a molecular weight of 403.35 g/mol, XLogP of 2.66, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[9-[(2,6-difluorophenyl)methyl]-8-oxo-7H-purin-2-yl]benzimidazole-5-carbonitrile is sourced from PubChem (CID 46879420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).