C25H23FN6O2 — CID 46879717
5-fluoro-2-[1-[6-(2-phenylphenoxy)pyrimidin-4-yl]piperidin-4-yl]oxypyrimidin-4-amine (PubChem CID 46879717) has the molecular formula C25H23FN6O2 and a molecular weight of 458.50 g/mol. Its IUPAC name is 5-fluoro-2-[1-[6-(2-phenylphenoxy)pyrimidin-4-yl]piperidin-4-yl]oxypyrimidin-4-amine.
| Compound Name | 5-fluoro-2-[1-[6-(2-phenylphenoxy)pyrimidin-4-yl]piperidin-4-yl]oxypyrimidin-4-amine |
|---|---|
| PubChem CID | 46879717 |
| Molecular Formula | C25H23FN6O2 |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 5-fluoro-2-[1-[6-(2-phenylphenoxy)pyrimidin-4-yl]piperidin-4-yl]oxypyrimidin-4-amine |
| SMILES | Nc1nc(OC2CCN(c3cc(Oc4ccccc4-c4ccccc4)ncn3)CC2)ncc1F |
| InChI | InChI=1S/C25H23FN6O2/c26-20-15-28-25(31-24(20)27)33-18-10-12-32(13-11-18)22-14-23(30-16-29-22)34-21-9-5-4-8-19(21)17-6-2-1-3-7-17/h1-9,14-16,18H,10-13H2,(H2,27,28,31) |
| InChIKey | HDEIPIHLEBSLGL-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 99.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |