C25H22F4N2O4 — CID 46879905
5-[4-butoxy-3-[[[2-fluoro-4-(trifluoromethyl)benzoyl]amino]methyl]phenyl]pyridine-2-carboxylic acid (PubChem CID 46879905) has the molecular formula C25H22F4N2O4 and a molecular weight of 490.45 g/mol. Its IUPAC name is 5-[4-butoxy-3-[[[2-fluoro-4-(trifluoromethyl)benzoyl]amino]methyl]phenyl]pyridine-2-carboxylic acid.
| Compound Name | 5-[4-butoxy-3-[[[2-fluoro-4-(trifluoromethyl)benzoyl]amino]methyl]phenyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 46879905 |
| Molecular Formula | C25H22F4N2O4 |
| Molecular Weight | 490.45 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | 5-[4-butoxy-3-[[[2-fluoro-4-(trifluoromethyl)benzoyl]amino]methyl]phenyl]pyridine-2-carboxylic acid |
| SMILES | CCCCOc1ccc(-c2ccc(C(=O)O)nc2)cc1CNC(=O)c1ccc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C25H22F4N2O4/c1-2-3-10-35-22-9-5-15(16-4-8-21(24(33)34)30-13-16)11-17(22)14-31-23(32)19-7-6-18(12-20(19)26)25(27,28)29/h4-9,11-13H,2-3,10,14H2,1H3,(H,31,32)(H,33,34) |
| InChIKey | RBUXBLQNKOTWJE-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.45 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|