About 1-[4-[(E)-3-(4-methoxyphenyl)prop-2-enyl]piperazin-1-yl]-6,6-diphenylhexan-1-one
1-[4-[(E)-3-(4-methoxyphenyl)prop-2-enyl]piperazin-1-yl]-6,6-diphenylhexan-1-one (PubChem CID 46880112) has the molecular formula C32H38N2O2
and a molecular weight of 482.67 g/mol. Its IUPAC name is 1-[4-[(E)-3-(4-methoxyphenyl)prop-2-enyl]piperazin-1-yl]-6,6-diphenylhexan-1-one.
Molecular Properties
| Compound Name | 1-[4-[(E)-3-(4-methoxyphenyl)prop-2-enyl]piperazin-1-yl]-6,6-diphenylhexan-1-one |
| PubChem CID | 46880112 |
| Molecular Formula | C32H38N2O2 |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | 1-[4-[(E)-3-(4-methoxyphenyl)prop-2-enyl]piperazin-1-yl]-6,6-diphenylhexan-1-one |
| SMILES | COc1ccc(/C=C/CN2CCN(C(=O)CCCCC(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C32H38N2O2/c1-36-30-20-18-27(19-21-30)11-10-22-33-23-25-34(26-24-33)32(35)17-9-8-16-31(28-12-4-2-5-13-28)29-14-6-3-7-15-29/h2-7,10-15,18-21,31H,8-9,16-17,22-26H2,1H3/b11-10+ |
| InChIKey | WAGKNCTULDCRRT-ZHACJKMWSA-N |
| XLogP | 6.25 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-[(E)-3-(4-methoxyphenyl)prop-2-enyl]piperazin-1-yl]-6,6-diphenylhexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[(E)-3-(4-methoxyphenyl)prop-2-enyl]piperazin-1-yl]-6,6-diphenylhexan-1-one?
The IUPAC name of 1-[4-[(E)-3-(4-methoxyphenyl)prop-2-enyl]piperazin-1-yl]-6,6-diphenylhexan-1-one (CID 46880112) is 1-[4-[(E)-3-(4-methoxyphenyl)prop-2-enyl]piperazin-1-yl]-6,6-diphenylhexan-1-one.
What is the SMILES notation for 1-[4-[(E)-3-(4-methoxyphenyl)prop-2-enyl]piperazin-1-yl]-6,6-diphenylhexan-1-one?
The canonical SMILES for 1-[4-[(E)-3-(4-methoxyphenyl)prop-2-enyl]piperazin-1-yl]-6,6-diphenylhexan-1-one is COc1ccc(/C=C/CN2CCN(C(=O)CCCCC(c3ccccc3)c3ccccc3)CC2)cc1.
What is the InChIKey of 1-[4-[(E)-3-(4-methoxyphenyl)prop-2-enyl]piperazin-1-yl]-6,6-diphenylhexan-1-one?
The InChIKey is WAGKNCTULDCRRT-ZHACJKMWSA-N. The full InChI is InChI=1S/C32H38N2O2/c1-36-30-20-18-27(19-21-30)11-10-22-33-23-25-34(26-24-33)32(35)17-9-8-16-31(28-12-4-2-5-13-28)29-14-6-3-7-15-29/h2-7,10-15,18-21,31H,8-9,16-17,22-26H2,1H3/b11-10+.
What are the key properties of 1-[4-[(E)-3-(4-methoxyphenyl)prop-2-enyl]piperazin-1-yl]-6,6-diphenylhexan-1-one?
1-[4-[(E)-3-(4-methoxyphenyl)prop-2-enyl]piperazin-1-yl]-6,6-diphenylhexan-1-one has a molecular weight of 482.67 g/mol, XLogP of 6.25, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[(E)-3-(4-methoxyphenyl)prop-2-enyl]piperazin-1-yl]-6,6-diphenylhexan-1-one is sourced from PubChem (CID 46880112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).