C29H34O10 — CID 46880126
[(1S,3S,4S,7R,9S,10S,11S,12S,14R,16S)-4-acetyloxy-9,11,12-trihydroxy-10,17,17-trimethyl-15-methylidene-2-oxo-6,13-dioxapentacyclo[12.3.1.03,10.04,7.012,16]octadecan-1-yl] benzoate (PubChem CID 46880126) has the molecular formula C29H34O10 and a molecular weight of 542.58 g/mol. Its IUPAC name is [(1S,3S,4S,7R,9S,10S,11S,12S,14R,16S)-4-acetyloxy-9,11,12-trihydroxy-10,17,17-trimethyl-15-methylidene-2-oxo-6,13-dioxapentacyclo[12.3.1.03,10.04,7.012,16]octadecan-1-yl] benzoate.
| Compound Name | [(1S,3S,4S,7R,9S,10S,11S,12S,14R,16S)-4-acetyloxy-9,11,12-trihydroxy-10,17,17-trimethyl-15-methylidene-2-oxo-6,13-dioxapentacyclo[12.3.1.03,10.04,7.012,16]octadecan-1-yl] benzoate |
|---|---|
| PubChem CID | 46880126 |
| Molecular Formula | C29H34O10 |
| Molecular Weight | 542.58 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | [(1S,3S,4S,7R,9S,10S,11S,12S,14R,16S)-4-acetyloxy-9,11,12-trihydroxy-10,17,17-trimethyl-15-methylidene-2-oxo-6,13-dioxapentacyclo[12.3.1.03,10.04,7.012,16]octadecan-1-yl] benzoate |
| SMILES | C=C1[C@H]2C[C@@]3(OC(=O)c4ccccc4)C(=O)[C@@H]4[C@]5(OC(C)=O)CO[C@@H]5C[C@H](O)[C@@]4(C)[C@H](O)[C@@](O)(O2)[C@@H]1C3(C)C |
| InChI | InChI=1S/C29H34O10/c1-14-17-12-28(39-23(33)16-9-7-6-8-10-16)22(32)21-26(5,24(34)29(35,38-17)20(14)25(28,3)4)18(31)11-19-27(21,13-36-19)37-15(2)30/h6-10,17-21,24,31,34-35H,1,11-13H2,2-5H3/t17-,18+,19-,20+,21+,24+,26-,27+,28-,29+/m1/s1 |
| InChIKey | HQWQXXGEQSGADW-VQISNLGGSA-N |
| XLogP | 1.30 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.58 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|