C29H36O11 — CID 46880127
[(1R,3S,4S,5S,6S,8S,9S,10S,12S,14S)-9-(acetyloxymethyl)-3,4,6,8,9-pentahydroxy-5,13,13-trimethyl-15-methylidene-11-oxo-2-oxatetracyclo[10.3.1.03,14.05,10]hexadecan-12-yl] benzoate (PubChem CID 46880127) has the molecular formula C29H36O11 and a molecular weight of 560.60 g/mol. Its IUPAC name is [(1R,3S,4S,5S,6S,8S,9S,10S,12S,14S)-9-(acetyloxymethyl)-3,4,6,8,9-pentahydroxy-5,13,13-trimethyl-15-methylidene-11-oxo-2-oxatetracyclo[10.3.1.03,14.05,10]hexadecan-12-yl] benzoate.
| Compound Name | [(1R,3S,4S,5S,6S,8S,9S,10S,12S,14S)-9-(acetyloxymethyl)-3,4,6,8,9-pentahydroxy-5,13,13-trimethyl-15-methylidene-11-oxo-2-oxatetracyclo[10.3.1.03,14.05,10]hexadecan-12-yl] benzoate |
|---|---|
| PubChem CID | 46880127 |
| Molecular Formula | C29H36O11 |
| Molecular Weight | 560.60 g/mol |
| Exact Mass | 560.23 |
| IUPAC Name | [(1R,3S,4S,5S,6S,8S,9S,10S,12S,14S)-9-(acetyloxymethyl)-3,4,6,8,9-pentahydroxy-5,13,13-trimethyl-15-methylidene-11-oxo-2-oxatetracyclo[10.3.1.03,14.05,10]hexadecan-12-yl] benzoate |
| SMILES | C=C1[C@H]2C[C@@]3(OC(=O)c4ccccc4)C(=O)[C@@H]4[C@](O)(COC(C)=O)[C@@H](O)C[C@H](O)[C@@]4(C)[C@H](O)[C@@](O)(O2)[C@@H]1C3(C)C |
| InChI | InChI=1S/C29H36O11/c1-14-17-12-28(40-23(34)16-9-7-6-8-10-16)22(33)21-26(5,24(35)29(37,39-17)20(14)25(28,3)4)18(31)11-19(32)27(21,36)13-38-15(2)30/h6-10,17-21,24,31-32,35-37H,1,11-13H2,2-5H3/t17-,18+,19+,20+,21+,24+,26-,27+,28-,29+/m1/s1 |
| InChIKey | IWNJXJOGOHJMPM-ZMDWXBMUSA-N |
| XLogP | 0.26 |
| TPSA | 180.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.60 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|