About 9-[(2,6-difluorophenyl)methyl]-2-(6-fluorobenzimidazol-1-yl)-7H-purin-8-one
9-[(2,6-difluorophenyl)methyl]-2-(6-fluorobenzimidazol-1-yl)-7H-purin-8-one (PubChem CID 46880197) has the molecular formula C19H11F3N6O
and a molecular weight of 396.33 g/mol. Its IUPAC name is 9-[(2,6-difluorophenyl)methyl]-2-(6-fluorobenzimidazol-1-yl)-7H-purin-8-one.
Molecular Properties
| Compound Name | 9-[(2,6-difluorophenyl)methyl]-2-(6-fluorobenzimidazol-1-yl)-7H-purin-8-one |
| PubChem CID | 46880197 |
| Molecular Formula | C19H11F3N6O |
| Molecular Weight | 396.33 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 9-[(2,6-difluorophenyl)methyl]-2-(6-fluorobenzimidazol-1-yl)-7H-purin-8-one |
| SMILES | O=c1[nH]c2cnc(-n3cnc4ccc(F)cc43)nc2n1Cc1c(F)cccc1F |
| InChI | InChI=1S/C19H11F3N6O/c20-10-4-5-14-16(6-10)28(9-24-14)18-23-7-15-17(26-18)27(19(29)25-15)8-11-12(21)2-1-3-13(11)22/h1-7,9H,8H2,(H,25,29) |
| InChIKey | PLBIOPHLHUUMDK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 81.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 9-[(2,6-difluorophenyl)methyl]-2-(6-fluorobenzimidazol-1-yl)-7H-purin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[(2,6-difluorophenyl)methyl]-2-(6-fluorobenzimidazol-1-yl)-7H-purin-8-one?
The IUPAC name of 9-[(2,6-difluorophenyl)methyl]-2-(6-fluorobenzimidazol-1-yl)-7H-purin-8-one (CID 46880197) is 9-[(2,6-difluorophenyl)methyl]-2-(6-fluorobenzimidazol-1-yl)-7H-purin-8-one.
What is the SMILES notation for 9-[(2,6-difluorophenyl)methyl]-2-(6-fluorobenzimidazol-1-yl)-7H-purin-8-one?
The canonical SMILES for 9-[(2,6-difluorophenyl)methyl]-2-(6-fluorobenzimidazol-1-yl)-7H-purin-8-one is O=c1[nH]c2cnc(-n3cnc4ccc(F)cc43)nc2n1Cc1c(F)cccc1F.
What is the InChIKey of 9-[(2,6-difluorophenyl)methyl]-2-(6-fluorobenzimidazol-1-yl)-7H-purin-8-one?
The InChIKey is PLBIOPHLHUUMDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H11F3N6O/c20-10-4-5-14-16(6-10)28(9-24-14)18-23-7-15-17(26-18)27(19(29)25-15)8-11-12(21)2-1-3-13(11)22/h1-7,9H,8H2,(H,25,29).
What are the key properties of 9-[(2,6-difluorophenyl)methyl]-2-(6-fluorobenzimidazol-1-yl)-7H-purin-8-one?
9-[(2,6-difluorophenyl)methyl]-2-(6-fluorobenzimidazol-1-yl)-7H-purin-8-one has a molecular weight of 396.33 g/mol, XLogP of 2.92, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[(2,6-difluorophenyl)methyl]-2-(6-fluorobenzimidazol-1-yl)-7H-purin-8-one is sourced from PubChem (CID 46880197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).