C22H30O6 — CID 46880219
[(1S,4E,4aS,7E,9R,11aR)-1-hydroxy-4-[(2R)-2-hydroxy-4-methylpent-3-enylidene]-7-methyl-11-methylidene-3-oxo-4a,5,6,9,10,11a-hexahydro-1H-cyclonona[c]pyran-9-yl] acetate (PubChem CID 46880219) has the molecular formula C22H30O6 and a molecular weight of 390.48 g/mol. Its IUPAC name is [(1S,4E,4aS,7E,9R,11aR)-1-hydroxy-4-[(2R)-2-hydroxy-4-methylpent-3-enylidene]-7-methyl-11-methylidene-3-oxo-4a,5,6,9,10,11a-hexahydro-1H-cyclonona[c]pyran-9-yl] acetate.
| Compound Name | [(1S,4E,4aS,7E,9R,11aR)-1-hydroxy-4-[(2R)-2-hydroxy-4-methylpent-3-enylidene]-7-methyl-11-methylidene-3-oxo-4a,5,6,9,10,11a-hexahydro-1H-cyclonona[c]pyran-9-yl] acetate |
|---|---|
| PubChem CID | 46880219 |
| Molecular Formula | C22H30O6 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | [(1S,4E,4aS,7E,9R,11aR)-1-hydroxy-4-[(2R)-2-hydroxy-4-methylpent-3-enylidene]-7-methyl-11-methylidene-3-oxo-4a,5,6,9,10,11a-hexahydro-1H-cyclonona[c]pyran-9-yl] acetate |
| SMILES | C=C1C[C@@H](OC(C)=O)/C=C(\C)CC[C@@H]2/C(=C\[C@H](O)C=C(C)C)C(=O)O[C@H](O)[C@@H]12 |
| InChI | InChI=1S/C22H30O6/c1-12(2)8-16(24)11-19-18-7-6-13(3)9-17(27-15(5)23)10-14(4)20(18)22(26)28-21(19)25/h8-9,11,16-18,20,22,24,26H,4,6-7,10H2,1-3,5H3/b13-9+,19-11+/t16-,17+,18-,20+,22+/m1/s1 |
| InChIKey | IIRCOZLSZWDRSU-OQMLVEEGSA-N |
| XLogP | 2.97 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|