About 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]benzonitrile
4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]benzonitrile (PubChem CID 46880245) has the molecular formula C16H10ClN3S
and a molecular weight of 311.80 g/mol. Its IUPAC name is 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]benzonitrile.
Molecular Properties
| Compound Name | 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]benzonitrile |
| PubChem CID | 46880245 |
| Molecular Formula | C16H10ClN3S |
| Molecular Weight | 311.80 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]benzonitrile |
| SMILES | N#Cc1ccc(Nc2nc(-c3ccc(Cl)cc3)cs2)cc1 |
| InChI | InChI=1S/C16H10ClN3S/c17-13-5-3-12(4-6-13)15-10-21-16(20-15)19-14-7-1-11(9-18)2-8-14/h1-8,10H,(H,19,20) |
| InChIKey | XHIKPDXEAYPBOD-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 311.80 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]benzonitrile?
The IUPAC name of 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]benzonitrile (CID 46880245) is 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]benzonitrile.
What is the SMILES notation for 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]benzonitrile?
The canonical SMILES for 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]benzonitrile is N#Cc1ccc(Nc2nc(-c3ccc(Cl)cc3)cs2)cc1.
What is the InChIKey of 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]benzonitrile?
The InChIKey is XHIKPDXEAYPBOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10ClN3S/c17-13-5-3-12(4-6-13)15-10-21-16(20-15)19-14-7-1-11(9-18)2-8-14/h1-8,10H,(H,19,20).
What are the key properties of 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]benzonitrile?
4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]benzonitrile has a molecular weight of 311.80 g/mol, XLogP of 5.08, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]benzonitrile is sourced from PubChem (CID 46880245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).