C22H20N2O4 — CID 46880303
3-[3-[(2R)-2,3-dihydroxypropyl]phenyl]-4-(1-methylindol-3-yl)pyrrole-2,5-dione (PubChem CID 46880303) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is 3-[3-[(2R)-2,3-dihydroxypropyl]phenyl]-4-(1-methylindol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[3-[(2R)-2,3-dihydroxypropyl]phenyl]-4-(1-methylindol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 46880303 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 3-[3-[(2R)-2,3-dihydroxypropyl]phenyl]-4-(1-methylindol-3-yl)pyrrole-2,5-dione |
| SMILES | Cn1cc(C2=C(c3cccc(C[C@@H](O)CO)c3)C(=O)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C22H20N2O4/c1-24-11-17(16-7-2-3-8-18(16)24)20-19(21(27)23-22(20)28)14-6-4-5-13(9-14)10-15(26)12-25/h2-9,11,15,25-26H,10,12H2,1H3,(H,23,27,28)/t15-/m1/s1 |
| InChIKey | IVLXFYOVQYKSNO-OAHLLOKOSA-N |
| XLogP | 1.64 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|