C24H19Cl2F3N4O2S — CID 46880411
2-(2,4-dichlorophenyl)-N'-methyl-3-phenyl-N-[4-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydropyrazole-5-carboximidamide (PubChem CID 46880411) has the molecular formula C24H19Cl2F3N4O2S and a molecular weight of 555.41 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-N'-methyl-3-phenyl-N-[4-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydropyrazole-5-carboximidamide.
| Compound Name | 2-(2,4-dichlorophenyl)-N'-methyl-3-phenyl-N-[4-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydropyrazole-5-carboximidamide |
|---|---|
| PubChem CID | 46880411 |
| Molecular Formula | C24H19Cl2F3N4O2S |
| Molecular Weight | 555.41 g/mol |
| Exact Mass | 554.06 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-N'-methyl-3-phenyl-N-[4-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydropyrazole-5-carboximidamide |
| SMILES | C/N=C(/NS(=O)(=O)c1ccc(C(F)(F)F)cc1)C1=NN(c2ccc(Cl)cc2Cl)C(c2ccccc2)C1 |
| InChI | InChI=1S/C24H19Cl2F3N4O2S/c1-30-23(32-36(34,35)18-10-7-16(8-11-18)24(27,28)29)20-14-22(15-5-3-2-4-6-15)33(31-20)21-12-9-17(25)13-19(21)26/h2-13,22H,14H2,1H3,(H,30,32) |
| InChIKey | KFUBUHJCBKCTEW-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 74.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.41 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|