About 3-(benzenesulfonyl)-N,N-diethyl-8-methyltriazolo[1,5-a]quinazolin-5-amine
3-(benzenesulfonyl)-N,N-diethyl-8-methyltriazolo[1,5-a]quinazolin-5-amine (PubChem CID 46880599) has the molecular formula C20H21N5O2S
and a molecular weight of 395.49 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-N,N-diethyl-8-methyltriazolo[1,5-a]quinazolin-5-amine.
Molecular Properties
| Compound Name | 3-(benzenesulfonyl)-N,N-diethyl-8-methyltriazolo[1,5-a]quinazolin-5-amine |
| PubChem CID | 46880599 |
| Molecular Formula | C20H21N5O2S |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 3-(benzenesulfonyl)-N,N-diethyl-8-methyltriazolo[1,5-a]quinazolin-5-amine |
| SMILES | CCN(CC)c1nc2c(S(=O)(=O)c3ccccc3)nnn2c2cc(C)ccc12 |
| InChI | InChI=1S/C20H21N5O2S/c1-4-24(5-2)18-16-12-11-14(3)13-17(16)25-19(21-18)20(22-23-25)28(26,27)15-9-7-6-8-10-15/h6-13H,4-5H2,1-3H3 |
| InChIKey | LECVUDBRIFGWJY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 80.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-(benzenesulfonyl)-N,N-diethyl-8-methyltriazolo[1,5-a]quinazolin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(benzenesulfonyl)-N,N-diethyl-8-methyltriazolo[1,5-a]quinazolin-5-amine?
The IUPAC name of 3-(benzenesulfonyl)-N,N-diethyl-8-methyltriazolo[1,5-a]quinazolin-5-amine (CID 46880599) is 3-(benzenesulfonyl)-N,N-diethyl-8-methyltriazolo[1,5-a]quinazolin-5-amine.
What is the SMILES notation for 3-(benzenesulfonyl)-N,N-diethyl-8-methyltriazolo[1,5-a]quinazolin-5-amine?
The canonical SMILES for 3-(benzenesulfonyl)-N,N-diethyl-8-methyltriazolo[1,5-a]quinazolin-5-amine is CCN(CC)c1nc2c(S(=O)(=O)c3ccccc3)nnn2c2cc(C)ccc12.
What is the InChIKey of 3-(benzenesulfonyl)-N,N-diethyl-8-methyltriazolo[1,5-a]quinazolin-5-amine?
The InChIKey is LECVUDBRIFGWJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N5O2S/c1-4-24(5-2)18-16-12-11-14(3)13-17(16)25-19(21-18)20(22-23-25)28(26,27)15-9-7-6-8-10-15/h6-13H,4-5H2,1-3H3.
What are the key properties of 3-(benzenesulfonyl)-N,N-diethyl-8-methyltriazolo[1,5-a]quinazolin-5-amine?
3-(benzenesulfonyl)-N,N-diethyl-8-methyltriazolo[1,5-a]quinazolin-5-amine has a molecular weight of 395.49 g/mol, XLogP of 3.26, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(benzenesulfonyl)-N,N-diethyl-8-methyltriazolo[1,5-a]quinazolin-5-amine is sourced from PubChem (CID 46880599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).