C24H15ClN6O4 — CID 46880652
N-[3-(4-chlorophenyl)-5-(3-nitrophenyl)-7-oxo-1H-pyrazolo[4,3-d]pyrimidin-6-yl]benzamide (PubChem CID 46880652) has the molecular formula C24H15ClN6O4 and a molecular weight of 486.88 g/mol. Its IUPAC name is N-[3-(4-chlorophenyl)-5-(3-nitrophenyl)-7-oxo-1H-pyrazolo[4,3-d]pyrimidin-6-yl]benzamide.
| Compound Name | N-[3-(4-chlorophenyl)-5-(3-nitrophenyl)-7-oxo-1H-pyrazolo[4,3-d]pyrimidin-6-yl]benzamide |
|---|---|
| PubChem CID | 46880652 |
| Molecular Formula | C24H15ClN6O4 |
| Molecular Weight | 486.88 g/mol |
| Exact Mass | 486.08 |
| IUPAC Name | N-[3-(4-chlorophenyl)-5-(3-nitrophenyl)-7-oxo-1H-pyrazolo[4,3-d]pyrimidin-6-yl]benzamide |
| SMILES | O=C(Nn1c(-c2cccc([N+](=O)[O-])c2)nc2c(-c3ccc(Cl)cc3)n[nH]c2c1=O)c1ccccc1 |
| InChI | InChI=1S/C24H15ClN6O4/c25-17-11-9-14(10-12-17)19-20-21(28-27-19)24(33)30(29-23(32)15-5-2-1-3-6-15)22(26-20)16-7-4-8-18(13-16)31(34)35/h1-13H,(H,27,28)(H,29,32) |
| InChIKey | NCNYVILNRVTJHC-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 135.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.88 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|