C18H35IN2O2 — CID 46881022
[4-[[(2R,5Z,8Z)-2-hydroxyundeca-5,8-dienyl]amino]-4-oxobutyl]-trimethylazanium iodide (PubChem CID 46881022) has the molecular formula C18H35IN2O2 and a molecular weight of 438.39 g/mol. Its IUPAC name is [4-[[(2R,5Z,8Z)-2-hydroxyundeca-5,8-dienyl]amino]-4-oxobutyl]-trimethylazanium iodide.
| Compound Name | [4-[[(2R,5Z,8Z)-2-hydroxyundeca-5,8-dienyl]amino]-4-oxobutyl]-trimethylazanium iodide |
|---|---|
| PubChem CID | 46881022 |
| Molecular Formula | C18H35IN2O2 |
| Molecular Weight | 438.39 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | [4-[[(2R,5Z,8Z)-2-hydroxyundeca-5,8-dienyl]amino]-4-oxobutyl]-trimethylazanium iodide |
| SMILES | CC/C=C\C/C=C\CC[C@@H](O)CNC(=O)CCC[N+](C)(C)C.[I-] |
| InChI | InChI=1S/C18H34N2O2.HI/c1-5-6-7-8-9-10-11-13-17(21)16-19-18(22)14-12-15-20(2,3)4;/h6-7,9-10,17,21H,5,8,11-16H2,1-4H3;1H/b7-6-,10-9-;/t17-;/m1./s1 |
| InChIKey | LRAGEEFGUPLALJ-ADIAGSJJSA-N |
| XLogP | -0.35 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.39 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|