C23H38O4 — CID 46881128
(2R,4aR,7S,9S,10aS)-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,1,4a,7-tetramethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthrene-2,9-diol (PubChem CID 46881128) has the molecular formula C23H38O4 and a molecular weight of 378.55 g/mol. Its IUPAC name is (2R,4aR,7S,9S,10aS)-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,1,4a,7-tetramethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthrene-2,9-diol.
| Compound Name | (2R,4aR,7S,9S,10aS)-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,1,4a,7-tetramethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthrene-2,9-diol |
|---|---|
| PubChem CID | 46881128 |
| Molecular Formula | C23H38O4 |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.28 |
| IUPAC Name | (2R,4aR,7S,9S,10aS)-7-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,1,4a,7-tetramethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthrene-2,9-diol |
| SMILES | CC1(C)OC[C@@H]([C@]2(C)C=C3C(CC2)[C@]2(C)CC[C@@H](O)C(C)(C)[C@H]2C[C@@H]3O)O1 |
| InChI | InChI=1S/C23H38O4/c1-20(2)17-11-16(24)14-12-22(5,19-13-26-21(3,4)27-19)9-7-15(14)23(17,6)10-8-18(20)25/h12,15-19,24-25H,7-11,13H2,1-6H3/t15?,16-,17+,18+,19-,22-,23-/m0/s1 |
| InChIKey | VRLDAMQNTHAYBJ-XFEFPBHUSA-N |
| XLogP | 4.05 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|