C21H30O4 — CID 46881214
(1S,2E,6S,8S,11E)-1,3,8,16-tetramethyl-7,18-dioxatricyclo[13.3.0.06,8]octadeca-2,11,15-triene-12-carboxylic acid (PubChem CID 46881214) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is (1S,2E,6S,8S,11E)-1,3,8,16-tetramethyl-7,18-dioxatricyclo[13.3.0.06,8]octadeca-2,11,15-triene-12-carboxylic acid.
| Compound Name | (1S,2E,6S,8S,11E)-1,3,8,16-tetramethyl-7,18-dioxatricyclo[13.3.0.06,8]octadeca-2,11,15-triene-12-carboxylic acid |
|---|---|
| PubChem CID | 46881214 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | (1S,2E,6S,8S,11E)-1,3,8,16-tetramethyl-7,18-dioxatricyclo[13.3.0.06,8]octadeca-2,11,15-triene-12-carboxylic acid |
| SMILES | CC1=C2CC/C(C(=O)O)=C\CC[C@]3(C)O[C@H]3CC/C(C)=C/[C@]2(C)OC1 |
| InChI | InChI=1S/C21H30O4/c1-14-7-10-18-20(3,25-18)11-5-6-16(19(22)23)8-9-17-15(2)13-24-21(17,4)12-14/h6,12,18H,5,7-11,13H2,1-4H3,(H,22,23)/b14-12+,16-6+/t18-,20-,21-/m0/s1 |
| InChIKey | HUOMKQZAMCFINY-RETLBYDRSA-N |
| XLogP | 4.56 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|