C19H32O3 — CID 46881226
(1R,2S,4E,6E,10R,11S)-2,7,11-trimethyl-4-propan-2-yl-14-oxabicyclo[8.3.1]tetradeca-4,6-diene-2,11-diol (PubChem CID 46881226) has the molecular formula C19H32O3 and a molecular weight of 308.46 g/mol. Its IUPAC name is (1R,2S,4E,6E,10R,11S)-2,7,11-trimethyl-4-propan-2-yl-14-oxabicyclo[8.3.1]tetradeca-4,6-diene-2,11-diol.
| Compound Name | (1R,2S,4E,6E,10R,11S)-2,7,11-trimethyl-4-propan-2-yl-14-oxabicyclo[8.3.1]tetradeca-4,6-diene-2,11-diol |
|---|---|
| PubChem CID | 46881226 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | (1R,2S,4E,6E,10R,11S)-2,7,11-trimethyl-4-propan-2-yl-14-oxabicyclo[8.3.1]tetradeca-4,6-diene-2,11-diol |
| SMILES | C/C1=C\C=C(\C(C)C)C[C@](C)(O)[C@H]2CC[C@](C)(O)[C@@H](CC1)O2 |
| InChI | InChI=1S/C19H32O3/c1-13(2)15-8-6-14(3)7-9-16-18(4,20)11-10-17(22-16)19(5,21)12-15/h6,8,13,16-17,20-21H,7,9-12H2,1-5H3/b14-6+,15-8+/t16-,17-,18+,19+/m1/s1 |
| InChIKey | ADRQUYQPINKXPW-RWOJJBTQSA-N |
| XLogP | 3.75 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |