C33H44O8 — CID 46881331
(1S,3R,5S,6R,8S,11R,13S,15R,16S,18R)-6-(hydroxymethyl)-11-methyl-15-phenylmethoxy-16-(2-phenylmethoxyethyl)-2,7,12,17-tetraoxatetracyclo[9.8.0.03,8.013,18]nonadecan-5-ol (PubChem CID 46881331) has the molecular formula C33H44O8 and a molecular weight of 568.71 g/mol. Its IUPAC name is (1S,3R,5S,6R,8S,11R,13S,15R,16S,18R)-6-(hydroxymethyl)-11-methyl-15-phenylmethoxy-16-(2-phenylmethoxyethyl)-2,7,12,17-tetraoxatetracyclo[9.8.0.03,8.013,18]nonadecan-5-ol.
| Compound Name | (1S,3R,5S,6R,8S,11R,13S,15R,16S,18R)-6-(hydroxymethyl)-11-methyl-15-phenylmethoxy-16-(2-phenylmethoxyethyl)-2,7,12,17-tetraoxatetracyclo[9.8.0.03,8.013,18]nonadecan-5-ol |
|---|---|
| PubChem CID | 46881331 |
| Molecular Formula | C33H44O8 |
| Molecular Weight | 568.71 g/mol |
| Exact Mass | 568.30 |
| IUPAC Name | (1S,3R,5S,6R,8S,11R,13S,15R,16S,18R)-6-(hydroxymethyl)-11-methyl-15-phenylmethoxy-16-(2-phenylmethoxyethyl)-2,7,12,17-tetraoxatetracyclo[9.8.0.03,8.013,18]nonadecan-5-ol |
| SMILES | C[C@@]12CC[C@@H]3O[C@H](CO)[C@@H](O)C[C@H]3O[C@H]1C[C@H]1O[C@@H](CCOCc3ccccc3)[C@H](OCc3ccccc3)C[C@@H]1O2 |
| InChI | InChI=1S/C33H44O8/c1-33-14-12-25-28(16-24(35)31(19-34)39-25)40-32(33)18-29-30(41-33)17-27(37-21-23-10-6-3-7-11-23)26(38-29)13-15-36-20-22-8-4-2-5-9-22/h2-11,24-32,34-35H,12-21H2,1H3/t24-,25-,26-,27+,28+,29+,30-,31+,32-,33+/m0/s1 |
| InChIKey | BHFICDSSZKJOFA-XEYLFFAPSA-N |
| XLogP | 3.94 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.71 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|