C22H28O5 — CID 46881334
(2R,3S,5R,6S)-2-(hydroxymethyl)-5-phenylmethoxy-6-(2-phenylmethoxyethyl)oxan-3-ol (PubChem CID 46881334) has the molecular formula C22H28O5 and a molecular weight of 372.46 g/mol. Its IUPAC name is (2R,3S,5R,6S)-2-(hydroxymethyl)-5-phenylmethoxy-6-(2-phenylmethoxyethyl)oxan-3-ol.
| Compound Name | (2R,3S,5R,6S)-2-(hydroxymethyl)-5-phenylmethoxy-6-(2-phenylmethoxyethyl)oxan-3-ol |
|---|---|
| PubChem CID | 46881334 |
| Molecular Formula | C22H28O5 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | (2R,3S,5R,6S)-2-(hydroxymethyl)-5-phenylmethoxy-6-(2-phenylmethoxyethyl)oxan-3-ol |
| SMILES | OC[C@H]1O[C@@H](CCOCc2ccccc2)[C@H](OCc2ccccc2)C[C@@H]1O |
| InChI | InChI=1S/C22H28O5/c23-14-22-19(24)13-21(26-16-18-9-5-2-6-10-18)20(27-22)11-12-25-15-17-7-3-1-4-8-17/h1-10,19-24H,11-16H2/t19-,20-,21+,22+/m0/s1 |
| InChIKey | MONANRYKMPEKTM-FNAHDJPLSA-N |
| XLogP | 2.69 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|