C17H14FN3O4S — CID 46881486
5-[(1,1-dioxo-3H-1,2-benzothiazol-2-yl)methyl]-5-(4-fluorophenyl)imidazolidine-2,4-dione (PubChem CID 46881486) has the molecular formula C17H14FN3O4S and a molecular weight of 375.38 g/mol. Its IUPAC name is 5-[(1,1-dioxo-3H-1,2-benzothiazol-2-yl)methyl]-5-(4-fluorophenyl)imidazolidine-2,4-dione.
| Compound Name | 5-[(1,1-dioxo-3H-1,2-benzothiazol-2-yl)methyl]-5-(4-fluorophenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 46881486 |
| Molecular Formula | C17H14FN3O4S |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 5-[(1,1-dioxo-3H-1,2-benzothiazol-2-yl)methyl]-5-(4-fluorophenyl)imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(CN2Cc3ccccc3S2(=O)=O)(c2ccc(F)cc2)N1 |
| InChI | InChI=1S/C17H14FN3O4S/c18-13-7-5-12(6-8-13)17(15(22)19-16(23)20-17)10-21-9-11-3-1-2-4-14(11)26(21,24)25/h1-8H,9-10H2,(H2,19,20,22,23) |
| InChIKey | NCEBBHOMOAWRPQ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|