C20H31NO2 — CID 46881496
4-[(4aS,5S,10bS)-9-tert-butyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]butan-1-ol (PubChem CID 46881496) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is 4-[(4aS,5S,10bS)-9-tert-butyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]butan-1-ol.
| Compound Name | 4-[(4aS,5S,10bS)-9-tert-butyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]butan-1-ol |
|---|---|
| PubChem CID | 46881496 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | 4-[(4aS,5S,10bS)-9-tert-butyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]butan-1-ol |
| SMILES | CC(C)(C)c1ccc2c(c1)[C@H]1OCCC[C@H]1[C@H](CCCCO)N2 |
| InChI | InChI=1S/C20H31NO2/c1-20(2,3)14-9-10-18-16(13-14)19-15(7-6-12-23-19)17(21-18)8-4-5-11-22/h9-10,13,15,17,19,21-22H,4-8,11-12H2,1-3H3/t15-,17-,19-/m0/s1 |
| InChIKey | XXAXXEVBKAQDRU-IEZWGBDMSA-N |
| XLogP | 4.41 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|