C24H28F3N3O3 — CID 46881497
1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-(3-hydroxypropyl)urea (PubChem CID 46881497) has the molecular formula C24H28F3N3O3 and a molecular weight of 463.50 g/mol. Its IUPAC name is 1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-(3-hydroxypropyl)urea.
| Compound Name | 1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-(3-hydroxypropyl)urea |
|---|---|
| PubChem CID | 46881497 |
| Molecular Formula | C24H28F3N3O3 |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | 1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-(3-hydroxypropyl)urea |
| SMILES | O=C(NCCCO)NC[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccccc1 |
| InChI | InChI=1S/C24H28F3N3O3/c25-24(26,27)16-7-10-20-19(13-16)22-18(21(30-20)15-5-2-1-3-6-15)9-8-17(33-22)14-29-23(32)28-11-4-12-31/h1-3,5-7,10,13,17-18,21-22,30-31H,4,8-9,11-12,14H2,(H2,28,29,32)/t17-,18+,21+,22+/m1/s1 |
| InChIKey | FDLZKAHBFBTSIT-KSCDAYEDSA-N |
| XLogP | 4.39 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|