C24H27N3O2 — CID 46881528
N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-2,5-dimethylbenzamide (PubChem CID 46881528) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-2,5-dimethylbenzamide.
| Compound Name | N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-2,5-dimethylbenzamide |
|---|---|
| PubChem CID | 46881528 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-2,5-dimethylbenzamide |
| SMILES | Cc1ccc(C)c(C(=O)Nc2ccc(CCNC[C@H](O)c3cccnc3)cc2)c1 |
| InChI | InChI=1S/C24H27N3O2/c1-17-5-6-18(2)22(14-17)24(29)27-21-9-7-19(8-10-21)11-13-26-16-23(28)20-4-3-12-25-15-20/h3-10,12,14-15,23,26,28H,11,13,16H2,1-2H3,(H,27,29)/t23-/m0/s1 |
| InChIKey | STJHLKDYKRBSBU-QHCPKHFHSA-N |
| XLogP | 3.82 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|