C28H30F3N3O — CID 46881581
N'-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-N'-phenylethane-1,2-diamine (PubChem CID 46881581) has the molecular formula C28H30F3N3O and a molecular weight of 481.56 g/mol. Its IUPAC name is N'-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-N'-phenylethane-1,2-diamine.
| Compound Name | N'-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-N'-phenylethane-1,2-diamine |
|---|---|
| PubChem CID | 46881581 |
| Molecular Formula | C28H30F3N3O |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | N'-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-N'-phenylethane-1,2-diamine |
| SMILES | NCCN(C[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H30F3N3O/c29-28(30,31)20-11-14-25-24(17-20)27-23(26(33-25)19-7-3-1-4-8-19)13-12-22(35-27)18-34(16-15-32)21-9-5-2-6-10-21/h1-11,14,17,22-23,26-27,33H,12-13,15-16,18,32H2/t22-,23+,26+,27+/m1/s1 |
| InChIKey | DPHOBSAVIIZAEE-DTBHQADXSA-N |
| XLogP | 6.17 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |