C30H32F3N3O2 — CID 46881582
N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-N-(2-aminoethyl)-4-methylbenzamide (PubChem CID 46881582) has the molecular formula C30H32F3N3O2 and a molecular weight of 523.60 g/mol. Its IUPAC name is N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-N-(2-aminoethyl)-4-methylbenzamide.
| Compound Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-N-(2-aminoethyl)-4-methylbenzamide |
|---|---|
| PubChem CID | 46881582 |
| Molecular Formula | C30H32F3N3O2 |
| Molecular Weight | 523.60 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-N-(2-aminoethyl)-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N(CCN)C[C@H]2CC[C@@H]3[C@H](O2)c2cc(C(F)(F)F)ccc2N[C@H]3c2ccccc2)cc1 |
| InChI | InChI=1S/C30H32F3N3O2/c1-19-7-9-21(10-8-19)29(37)36(16-15-34)18-23-12-13-24-27(20-5-3-2-4-6-20)35-26-14-11-22(30(31,32)33)17-25(26)28(24)38-23/h2-11,14,17,23-24,27-28,35H,12-13,15-16,18,34H2,1H3/t23-,24+,27+,28+/m1/s1 |
| InChIKey | RAQSTOCPDXWQMP-JGPKDBRGSA-N |
| XLogP | 6.12 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.60 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |