C19H23N7O2 — CID 46881615
2-(3-amino-1,2,4-triazol-1-yl)-N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]acetamide (PubChem CID 46881615) has the molecular formula C19H23N7O2 and a molecular weight of 381.44 g/mol. Its IUPAC name is 2-(3-amino-1,2,4-triazol-1-yl)-N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]acetamide.
| Compound Name | 2-(3-amino-1,2,4-triazol-1-yl)-N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 46881615 |
| Molecular Formula | C19H23N7O2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 2-(3-amino-1,2,4-triazol-1-yl)-N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]acetamide |
| SMILES | Nc1ncn(CC(=O)Nc2ccc(CCNC[C@H](O)c3cccnc3)cc2)n1 |
| InChI | InChI=1S/C19H23N7O2/c20-19-23-13-26(25-19)12-18(28)24-16-5-3-14(4-6-16)7-9-22-11-17(27)15-2-1-8-21-10-15/h1-6,8,10,13,17,22,27H,7,9,11-12H2,(H2,20,25)(H,24,28)/t17-/m0/s1 |
| InChIKey | QAJQFWYRAMOYGX-KRWDZBQOSA-N |
| XLogP | 0.76 |
| TPSA | 130.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|