C21H22F4N2O — CID 46881627
1-[(2R,4aS,5R,10bS)-5-(4-fluorophenyl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]-N-methylmethanamine (PubChem CID 46881627) has the molecular formula C21H22F4N2O and a molecular weight of 394.41 g/mol. Its IUPAC name is 1-[(2R,4aS,5R,10bS)-5-(4-fluorophenyl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]-N-methylmethanamine.
| Compound Name | 1-[(2R,4aS,5R,10bS)-5-(4-fluorophenyl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 46881627 |
| Molecular Formula | C21H22F4N2O |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 1-[(2R,4aS,5R,10bS)-5-(4-fluorophenyl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]-N-methylmethanamine |
| SMILES | CNC[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccc(F)cc1 |
| InChI | InChI=1S/C21H22F4N2O/c1-26-11-15-7-8-16-19(12-2-5-14(22)6-3-12)27-18-9-4-13(21(23,24)25)10-17(18)20(16)28-15/h2-6,9-10,15-16,19-20,26-27H,7-8,11H2,1H3/t15-,16+,19+,20+/m1/s1 |
| InChIKey | GNUQYDHZSXFOIQ-LPWQTFTOSA-N |
| XLogP | 5.07 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |