C27H38N2O2 — CID 46881629
2-[[(2R,4aS,5R,10bS)-9-tert-butyl-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl-ethylamino]ethanol (PubChem CID 46881629) has the molecular formula C27H38N2O2 and a molecular weight of 422.61 g/mol. Its IUPAC name is 2-[[(2R,4aS,5R,10bS)-9-tert-butyl-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl-ethylamino]ethanol.
| Compound Name | 2-[[(2R,4aS,5R,10bS)-9-tert-butyl-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl-ethylamino]ethanol |
|---|---|
| PubChem CID | 46881629 |
| Molecular Formula | C27H38N2O2 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | 2-[[(2R,4aS,5R,10bS)-9-tert-butyl-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl-ethylamino]ethanol |
| SMILES | CCN(CCO)C[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(C)(C)C)ccc1N[C@H]2c1ccccc1 |
| InChI | InChI=1S/C27H38N2O2/c1-5-29(15-16-30)18-21-12-13-22-25(19-9-7-6-8-10-19)28-24-14-11-20(27(2,3)4)17-23(24)26(22)31-21/h6-11,14,17,21-22,25-26,28,30H,5,12-13,15-16,18H2,1-4H3/t21-,22+,25+,26+/m1/s1 |
| InChIKey | ZPKHWMSZZOQAOU-HRHCJDDBSA-N |
| XLogP | 5.30 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |