C26H26N4O2S — CID 46881651
N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-2-(4-phenyl-1,3-thiazol-2-yl)acetamide (PubChem CID 46881651) has the molecular formula C26H26N4O2S and a molecular weight of 458.59 g/mol. Its IUPAC name is N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-2-(4-phenyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-2-(4-phenyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 46881651 |
| Molecular Formula | C26H26N4O2S |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-2-(4-phenyl-1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(Cc1nc(-c2ccccc2)cs1)Nc1ccc(CCNC[C@H](O)c2cccnc2)cc1 |
| InChI | InChI=1S/C26H26N4O2S/c31-24(21-7-4-13-27-16-21)17-28-14-12-19-8-10-22(11-9-19)29-25(32)15-26-30-23(18-33-26)20-5-2-1-3-6-20/h1-11,13,16,18,24,28,31H,12,14-15,17H2,(H,29,32)/t24-/m0/s1 |
| InChIKey | FEZCEVIDMRCUGC-DEOSSOPVSA-N |
| XLogP | 4.25 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|