C23H30O6 — CID 46881659
(2R,3R,4S,5S,6R)-2-[[3-[(4-ethylphenyl)methyl]-4-methylphenyl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 46881659) has the molecular formula C23H30O6 and a molecular weight of 402.49 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[[3-[(4-ethylphenyl)methyl]-4-methylphenyl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[[3-[(4-ethylphenyl)methyl]-4-methylphenyl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 46881659 |
| Molecular Formula | C23H30O6 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[[3-[(4-ethylphenyl)methyl]-4-methylphenyl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCc1ccc(Cc2cc(CO[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)ccc2C)cc1 |
| InChI | InChI=1S/C23H30O6/c1-3-15-6-8-16(9-7-15)10-18-11-17(5-4-14(18)2)13-28-23-22(27)21(26)20(25)19(12-24)29-23/h4-9,11,19-27H,3,10,12-13H2,1-2H3/t19-,20-,21+,22-,23-/m1/s1 |
| InChIKey | GFMWQSLNMOIWEQ-XNBWIAOKSA-N |
| XLogP | 1.46 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |