C27H39N3O3S — CID 46881664
N-[[(2R,4aS,5R,10bS)-5-phenyl-9-propan-2-yl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-(dimethylamino)propane-1-sulfonamide (PubChem CID 46881664) has the molecular formula C27H39N3O3S and a molecular weight of 485.69 g/mol. Its IUPAC name is N-[[(2R,4aS,5R,10bS)-5-phenyl-9-propan-2-yl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-(dimethylamino)propane-1-sulfonamide.
| Compound Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-propan-2-yl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-(dimethylamino)propane-1-sulfonamide |
|---|---|
| PubChem CID | 46881664 |
| Molecular Formula | C27H39N3O3S |
| Molecular Weight | 485.69 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-propan-2-yl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-(dimethylamino)propane-1-sulfonamide |
| SMILES | CC(C)c1ccc2c(c1)[C@H]1O[C@@H](CNS(=O)(=O)CCCN(C)C)CC[C@H]1[C@H](c1ccccc1)N2 |
| InChI | InChI=1S/C27H39N3O3S/c1-19(2)21-11-14-25-24(17-21)27-23(26(29-25)20-9-6-5-7-10-20)13-12-22(33-27)18-28-34(31,32)16-8-15-30(3)4/h5-7,9-11,14,17,19,22-23,26-29H,8,12-13,15-16,18H2,1-4H3/t22-,23+,26+,27+/m1/s1 |
| InChIKey | FBIGJOOZDUWKCV-DTBHQADXSA-N |
| XLogP | 4.68 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.69 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |