C22H28O5 — CID 46881708
(2S,3R,4R,5R,6R)-2-[3-[(4-ethylphenyl)methyl]-4-methylphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 46881708) has the molecular formula C22H28O5 and a molecular weight of 372.46 g/mol. Its IUPAC name is (2S,3R,4R,5R,6R)-2-[3-[(4-ethylphenyl)methyl]-4-methylphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5R,6R)-2-[3-[(4-ethylphenyl)methyl]-4-methylphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 46881708 |
| Molecular Formula | C22H28O5 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | (2S,3R,4R,5R,6R)-2-[3-[(4-ethylphenyl)methyl]-4-methylphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCc1ccc(Cc2cc([C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)ccc2C)cc1 |
| InChI | InChI=1S/C22H28O5/c1-3-14-5-7-15(8-6-14)10-17-11-16(9-4-13(17)2)22-21(26)20(25)19(24)18(12-23)27-22/h4-9,11,18-26H,3,10,12H2,1-2H3/t18-,19+,20+,21-,22+/m1/s1 |
| InChIKey | IOUMMDDMHYSAMP-CTWRKMMKSA-N |
| XLogP | 1.66 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |