C23H29ClFN3O3S — CID 46881712
N-[[(2R,4aS,5R,10bS)-9-chloro-7-fluoro-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-2-(dimethylamino)ethanesulfonamide (PubChem CID 46881712) has the molecular formula C23H29ClFN3O3S and a molecular weight of 482.02 g/mol. Its IUPAC name is N-[[(2R,4aS,5R,10bS)-9-chloro-7-fluoro-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-2-(dimethylamino)ethanesulfonamide.
| Compound Name | N-[[(2R,4aS,5R,10bS)-9-chloro-7-fluoro-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-2-(dimethylamino)ethanesulfonamide |
|---|---|
| PubChem CID | 46881712 |
| Molecular Formula | C23H29ClFN3O3S |
| Molecular Weight | 482.02 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | N-[[(2R,4aS,5R,10bS)-9-chloro-7-fluoro-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-2-(dimethylamino)ethanesulfonamide |
| SMILES | CN(C)CCS(=O)(=O)NC[C@H]1CC[C@@H]2[C@H](O1)c1cc(Cl)cc(F)c1N[C@H]2c1ccccc1 |
| InChI | InChI=1S/C23H29ClFN3O3S/c1-28(2)10-11-32(29,30)26-14-17-8-9-18-21(15-6-4-3-5-7-15)27-22-19(23(18)31-17)12-16(24)13-20(22)25/h3-7,12-13,17-18,21,23,26-27H,8-11,14H2,1-2H3/t17-,18+,21+,23+/m1/s1 |
| InChIKey | XNXPMZDKAOHHSM-GPFNJZLUSA-N |
| XLogP | 3.96 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.02 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |