C23H23N5O2 — CID 46881796
N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]pyrazolo[1,5-a]pyridine-7-carboxamide (PubChem CID 46881796) has the molecular formula C23H23N5O2 and a molecular weight of 401.47 g/mol. Its IUPAC name is N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]pyrazolo[1,5-a]pyridine-7-carboxamide.
| Compound Name | N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]pyrazolo[1,5-a]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 46881796 |
| Molecular Formula | C23H23N5O2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]pyrazolo[1,5-a]pyridine-7-carboxamide |
| SMILES | O=C(Nc1ccc(CCNC[C@H](O)c2cccnc2)cc1)c1cccc2ccnn12 |
| InChI | InChI=1S/C23H23N5O2/c29-22(18-3-2-12-24-15-18)16-25-13-10-17-6-8-19(9-7-17)27-23(30)21-5-1-4-20-11-14-26-28(20)21/h1-9,11-12,14-15,22,25,29H,10,13,16H2,(H,27,30)/t22-/m0/s1 |
| InChIKey | XHNDFNBWFFSSFS-QFIPXVFZSA-N |
| XLogP | 2.85 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|