C23H29N5O2 — CID 46881870
2-(3,5-dimethylpyrazol-1-yl)-N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]propanamide (PubChem CID 46881870) has the molecular formula C23H29N5O2 and a molecular weight of 407.52 g/mol. Its IUPAC name is 2-(3,5-dimethylpyrazol-1-yl)-N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]propanamide.
| Compound Name | 2-(3,5-dimethylpyrazol-1-yl)-N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]propanamide |
|---|---|
| PubChem CID | 46881870 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 2-(3,5-dimethylpyrazol-1-yl)-N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]propanamide |
| SMILES | Cc1cc(C)n(C(C)C(=O)Nc2ccc(CCNC[C@H](O)c3cccnc3)cc2)n1 |
| InChI | InChI=1S/C23H29N5O2/c1-16-13-17(2)28(27-16)18(3)23(30)26-21-8-6-19(7-9-21)10-12-25-15-22(29)20-5-4-11-24-14-20/h4-9,11,13-14,18,22,25,29H,10,12,15H2,1-3H3,(H,26,30)/t18?,22-/m0/s1 |
| InChIKey | YPOOSHWMFUBQBB-YSYXNDDBSA-N |
| XLogP | 2.96 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|