C21H25N5O2S — CID 46881872
N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-2-[2-(methylamino)-1,3-thiazol-4-yl]acetamide (PubChem CID 46881872) has the molecular formula C21H25N5O2S and a molecular weight of 411.53 g/mol. Its IUPAC name is N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-2-[2-(methylamino)-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-2-[2-(methylamino)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 46881872 |
| Molecular Formula | C21H25N5O2S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-2-[2-(methylamino)-1,3-thiazol-4-yl]acetamide |
| SMILES | CNc1nc(CC(=O)Nc2ccc(CCNC[C@H](O)c3cccnc3)cc2)cs1 |
| InChI | InChI=1S/C21H25N5O2S/c1-22-21-26-18(14-29-21)11-20(28)25-17-6-4-15(5-7-17)8-10-24-13-19(27)16-3-2-9-23-12-16/h2-7,9,12,14,19,24,27H,8,10-11,13H2,1H3,(H,22,26)(H,25,28)/t19-/m0/s1 |
| InChIKey | GQMWHWAKKXESKL-IBGZPJMESA-N |
| XLogP | 2.63 |
| TPSA | 99.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|