C27H36N6O4 — CID 46881874
(2S)-2-[[3-[3-[[4-(aminomethyl)cyclohexanecarbonyl]amino]phenyl]benzoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 46881874) has the molecular formula C27H36N6O4 and a molecular weight of 508.62 g/mol. Its IUPAC name is (2S)-2-[[3-[3-[[4-(aminomethyl)cyclohexanecarbonyl]amino]phenyl]benzoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[[3-[3-[[4-(aminomethyl)cyclohexanecarbonyl]amino]phenyl]benzoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 46881874 |
| Molecular Formula | C27H36N6O4 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | (2S)-2-[[3-[3-[[4-(aminomethyl)cyclohexanecarbonyl]amino]phenyl]benzoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NCC1CCC(C(=O)Nc2cccc(-c3cccc(C(=O)N[C@@H](CCCN=C(N)N)C(=O)O)c3)c2)CC1 |
| InChI | InChI=1S/C27H36N6O4/c28-16-17-9-11-18(12-10-17)24(34)32-22-7-2-5-20(15-22)19-4-1-6-21(14-19)25(35)33-23(26(36)37)8-3-13-31-27(29)30/h1-2,4-7,14-15,17-18,23H,3,8-13,16,28H2,(H,32,34)(H,33,35)(H,36,37)(H4,29,30,31)/t17?,18?,23-/m0/s1 |
| InChIKey | SFFWUJSMMHUQNX-KXXGJQBSSA-N |
| XLogP | 2.29 |
| TPSA | 185.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|