C28H27N3O2 — CID 46881899
N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-2-phenylbenzamide (PubChem CID 46881899) has the molecular formula C28H27N3O2 and a molecular weight of 437.54 g/mol. Its IUPAC name is N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-2-phenylbenzamide.
| Compound Name | N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-2-phenylbenzamide |
|---|---|
| PubChem CID | 46881899 |
| Molecular Formula | C28H27N3O2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-2-phenylbenzamide |
| SMILES | O=C(Nc1ccc(CCNC[C@H](O)c2cccnc2)cc1)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C28H27N3O2/c32-27(23-9-6-17-29-19-23)20-30-18-16-21-12-14-24(15-13-21)31-28(33)26-11-5-4-10-25(26)22-7-2-1-3-8-22/h1-15,17,19,27,30,32H,16,18,20H2,(H,31,33)/t27-/m0/s1 |
| InChIKey | LMXDOEYEXPQYLB-MHZLTWQESA-N |
| XLogP | 4.87 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|