C20H24N2O — CID 46881907
(4aS,5R,10bS)-N,N-dimethyl-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-9-amine (PubChem CID 46881907) has the molecular formula C20H24N2O and a molecular weight of 308.43 g/mol. Its IUPAC name is (4aS,5R,10bS)-N,N-dimethyl-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-9-amine.
| Compound Name | (4aS,5R,10bS)-N,N-dimethyl-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-9-amine |
|---|---|
| PubChem CID | 46881907 |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | (4aS,5R,10bS)-N,N-dimethyl-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-9-amine |
| SMILES | CN(C)c1ccc2c(c1)[C@H]1OCCC[C@H]1[C@H](c1ccccc1)N2 |
| InChI | InChI=1S/C20H24N2O/c1-22(2)15-10-11-18-17(13-15)20-16(9-6-12-23-20)19(21-18)14-7-4-3-5-8-14/h3-5,7-8,10-11,13,16,19-21H,6,9,12H2,1-2H3/t16-,19-,20-/m0/s1 |
| InChIKey | VXLNQNLWDHJAKM-VDGAXYAQSA-N |
| XLogP | 4.39 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |